C17H25FN2O — CID 178150244
(2R)-4-[2-(3-fluoro-4-methylphenyl)ethyl]-2-methyl-1-prop-2-enoxypiperazine (PubChem CID 178150244) has the molecular formula C17H25FN2O and a molecular weight of 292.40 g/mol. Its IUPAC name is (2R)-4-[2-(3-fluoro-4-methylphenyl)ethyl]-2-methyl-1-prop-2-enoxypiperazine.
| Compound Name | (2R)-4-[2-(3-fluoro-4-methylphenyl)ethyl]-2-methyl-1-prop-2-enoxypiperazine |
|---|---|
| PubChem CID | 178150244 |
| Molecular Formula | C17H25FN2O |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (2R)-4-[2-(3-fluoro-4-methylphenyl)ethyl]-2-methyl-1-prop-2-enoxypiperazine |
| SMILES | C=CCON1CCN(CCc2ccc(C)c(F)c2)C[C@H]1C |
| InChI | InChI=1S/C17H25FN2O/c1-4-11-21-20-10-9-19(13-15(20)3)8-7-16-6-5-14(2)17(18)12-16/h4-6,12,15H,1,7-11,13H2,2-3H3/t15-/m1/s1 |
| InChIKey | DGKRDCIVLPITLD-OAHLLOKOSA-N |
| XLogP | 2.80 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|