C6H10ClN3O — CID 178150946
(2Z,4E)-2,5-diamino-5-chloro-N-methylpenta-2,4-dienamide (PubChem CID 178150946) has the molecular formula C6H10ClN3O and a molecular weight of 175.62 g/mol. Its IUPAC name is (2Z,4E)-2,5-diamino-5-chloro-N-methylpenta-2,4-dienamide.
| Compound Name | (2Z,4E)-2,5-diamino-5-chloro-N-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 178150946 |
| Molecular Formula | C6H10ClN3O |
| Molecular Weight | 175.62 g/mol |
| Exact Mass | 175.05 |
| IUPAC Name | (2Z,4E)-2,5-diamino-5-chloro-N-methylpenta-2,4-dienamide |
| SMILES | CNC(=O)/C(N)=C/C=C(\N)Cl |
| InChI | InChI=1S/C6H10ClN3O/c1-10-6(11)4(8)2-3-5(7)9/h2-3H,8-9H2,1H3,(H,10,11)/b4-2-,5-3- |
| InChIKey | SLKMYFFNRNSJJS-JVLMNHKTSA-N |
| XLogP | -0.39 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.62 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|