About CID 178151592
CID 178151592 (PubChem CID 178151592) has the molecular formula C23H26B3ClF3N5O3
and a molecular weight of 545.38 g/mol.
Molecular Properties
| Compound Name | CID 178151592 |
| PubChem CID | 178151592 |
| Molecular Formula | C23H26B3ClF3N5O3 |
| Molecular Weight | 545.38 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | — |
| SMILES | CCC.[B]C([B])([B])n1cc(C(F)(F)F)nc1-c1ccc(CNc2nc(Cl)ncc2OC)c(OC(C)CO)c1 |
| InChI | InChI=1S/C20H18B3ClF3N5O3.C3H8/c1-10(9-33)35-13-5-11(17-30-15(19(25,26)27)8-32(17)20(21,22)23)3-4-12(13)6-28-16-14(34-2)7-29-18(24)31-16;1-3-2/h3-5,7-8,10,33H,6,9H2,1-2H3,(H,28,29,31);3H2,1-2H3 |
| InChIKey | UMMNTBZWCKHGQP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 545.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 178151592 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178151592?
The IUPAC name of CID 178151592 (CID 178151592) is not available.
What is the SMILES notation for CID 178151592?
The canonical SMILES for CID 178151592 is CCC.[B]C([B])([B])n1cc(C(F)(F)F)nc1-c1ccc(CNc2nc(Cl)ncc2OC)c(OC(C)CO)c1.
What is the InChIKey of CID 178151592?
The InChIKey is UMMNTBZWCKHGQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18B3ClF3N5O3.C3H8/c1-10(9-33)35-13-5-11(17-30-15(19(25,26)27)8-32(17)20(21,22)23)3-4-12(13)6-28-16-14(34-2)7-29-18(24)31-16;1-3-2/h3-5,7-8,10,33H,6,9H2,1-2H3,(H,28,29,31);3H2,1-2H3.
What are the key properties of CID 178151592?
CID 178151592 has a molecular weight of 545.38 g/mol, XLogP of 3.88, 9 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178151592 is sourced from PubChem (CID 178151592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).