About S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane
S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane (PubChem CID 178151839) has the molecular formula C12H20N2S
and a molecular weight of 224.37 g/mol. Its IUPAC name is S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane.
Molecular Properties
| Compound Name | S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane |
| PubChem CID | 178151839 |
| Molecular Formula | C12H20N2S |
| Molecular Weight | 224.37 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane |
| SMILES | CC.Cc1cc2c(cc1SN)NC(C)C2 |
| InChI | InChI=1S/C10H14N2S.C2H6/c1-6-3-8-4-7(2)12-9(8)5-10(6)13-11;1-2/h3,5,7,12H,4,11H2,1-2H3;1-2H3 |
| InChIKey | QTXAYAVNJPFKEY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.37 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane?
The IUPAC name of S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane (CID 178151839) is S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane.
What is the SMILES notation for S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane?
The canonical SMILES for S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane is CC.Cc1cc2c(cc1SN)NC(C)C2.
What is the InChIKey of S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane?
The InChIKey is QTXAYAVNJPFKEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2S.C2H6/c1-6-3-8-4-7(2)12-9(8)5-10(6)13-11;1-2/h3,5,7,12H,4,11H2,1-2H3;1-2H3.
What are the key properties of S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane?
S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane has a molecular weight of 224.37 g/mol, XLogP of 3.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2,5-dimethyl-2,3-dihydro-1H-indol-6-yl)thiohydroxylamine;ethane is sourced from PubChem (CID 178151839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).