C18H32N6O — CID 178152198
(2Z,4E)-2,5-diamino-5-[(6-ethyl-2-methylpyrimidin-4-yl)amino]-N-methyl-3-propan-2-ylpenta-2,4-dienamide;ethane (PubChem CID 178152198) has the molecular formula C18H32N6O and a molecular weight of 348.50 g/mol. Its IUPAC name is (2Z,4E)-2,5-diamino-5-[(6-ethyl-2-methylpyrimidin-4-yl)amino]-N-methyl-3-propan-2-ylpenta-2,4-dienamide;ethane.
| Compound Name | (2Z,4E)-2,5-diamino-5-[(6-ethyl-2-methylpyrimidin-4-yl)amino]-N-methyl-3-propan-2-ylpenta-2,4-dienamide;ethane |
|---|---|
| PubChem CID | 178152198 |
| Molecular Formula | C18H32N6O |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.26 |
| IUPAC Name | (2Z,4E)-2,5-diamino-5-[(6-ethyl-2-methylpyrimidin-4-yl)amino]-N-methyl-3-propan-2-ylpenta-2,4-dienamide;ethane |
| SMILES | CC.CCc1cc(N/C(N)=C/C(=C(\N)C(=O)NC)C(C)C)nc(C)n1 |
| InChI | InChI=1S/C16H26N6O.C2H6/c1-6-11-7-14(21-10(4)20-11)22-13(17)8-12(9(2)3)15(18)16(23)19-5;1-2/h7-9H,6,17-18H2,1-5H3,(H,19,23)(H,20,21,22);1-2H3/b13-8+,15-12+; |
| InChIKey | ZFPZSJDSAMJZQK-NDVQNGNLSA-N |
| XLogP | 2.20 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|