C20H35N3O — CID 178152263
ethane;[6-[methyl-(3-methylcyclobutyl)amino]-2-pyridinyl]-pyrrolidin-1-ylmethanone (PubChem CID 178152263) has the molecular formula C20H35N3O and a molecular weight of 333.52 g/mol. Its IUPAC name is ethane;[6-[methyl-(3-methylcyclobutyl)amino]-2-pyridinyl]-pyrrolidin-1-ylmethanone.
| Compound Name | ethane;[6-[methyl-(3-methylcyclobutyl)amino]-2-pyridinyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 178152263 |
| Molecular Formula | C20H35N3O |
| Molecular Weight | 333.52 g/mol |
| Exact Mass | 333.28 |
| IUPAC Name | ethane;[6-[methyl-(3-methylcyclobutyl)amino]-2-pyridinyl]-pyrrolidin-1-ylmethanone |
| SMILES | CC.CC.CC1CC(N(C)c2cccc(C(=O)N3CCCC3)n2)C1 |
| InChI | InChI=1S/C16H23N3O.2C2H6/c1-12-10-13(11-12)18(2)15-7-5-6-14(17-15)16(20)19-8-3-4-9-19;2*1-2/h5-7,12-13H,3-4,8-11H2,1-2H3;2*1-2H3 |
| InChIKey | KSSODTTWRAUKFB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |