C7H13N3 — CID 178154716
(3R)-6-methanimidoyl-3-methyl-1,2,3,4-tetrahydropyridin-5-amine (PubChem CID 178154716) has the molecular formula C7H13N3 and a molecular weight of 139.20 g/mol. Its IUPAC name is (3R)-6-methanimidoyl-3-methyl-1,2,3,4-tetrahydropyridin-5-amine.
| Compound Name | (3R)-6-methanimidoyl-3-methyl-1,2,3,4-tetrahydropyridin-5-amine |
|---|---|
| PubChem CID | 178154716 |
| Molecular Formula | C7H13N3 |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.11 |
| IUPAC Name | (3R)-6-methanimidoyl-3-methyl-1,2,3,4-tetrahydropyridin-5-amine |
| SMILES | [H]/N=C/C1=C(N)C[C@@H](C)CN1 |
| InChI | InChI=1S/C7H13N3/c1-5-2-6(9)7(3-8)10-4-5/h3,5,8,10H,2,4,9H2,1H3/b8-3+/t5-/m1/s1 |
| InChIKey | ZRSLDVBFRCBVJX-DKJYPSCKSA-N |
| XLogP | 0.44 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|