About ethane;3-methylcyclobutane-1-carbonitrile;tungsten
ethane;3-methylcyclobutane-1-carbonitrile;tungsten (PubChem CID 178155727) has the molecular formula C8H14NW-
and a molecular weight of 308.05 g/mol. Its IUPAC name is ethane;3-methylcyclobutane-1-carbonitrile;tungsten.
Molecular Properties
| Compound Name | ethane;3-methylcyclobutane-1-carbonitrile;tungsten |
| PubChem CID | 178155727 |
| Molecular Formula | C8H14NW- |
| Molecular Weight | 308.05 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | ethane;3-methylcyclobutane-1-carbonitrile;tungsten |
| SMILES | CC.C[C-]1CC(C#N)C1.[W] |
| InChI | InChI=1S/C6H8N.C2H6.W/c1-5-2-6(3-5)4-7;1-2;/h6H,2-3H2,1H3;1-2H3;/q-1;; |
| InChIKey | LCSSJIMNQLKPON-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.05 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-methylcyclobutane-1-carbonitrile;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-methylcyclobutane-1-carbonitrile;tungsten?
The IUPAC name of ethane;3-methylcyclobutane-1-carbonitrile;tungsten (CID 178155727) is ethane;3-methylcyclobutane-1-carbonitrile;tungsten.
What is the SMILES notation for ethane;3-methylcyclobutane-1-carbonitrile;tungsten?
The canonical SMILES for ethane;3-methylcyclobutane-1-carbonitrile;tungsten is CC.C[C-]1CC(C#N)C1.[W].
What is the InChIKey of ethane;3-methylcyclobutane-1-carbonitrile;tungsten?
The InChIKey is LCSSJIMNQLKPON-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N.C2H6.W/c1-5-2-6(3-5)4-7;1-2;/h6H,2-3H2,1H3;1-2H3;/q-1;;.
What are the key properties of ethane;3-methylcyclobutane-1-carbonitrile;tungsten?
ethane;3-methylcyclobutane-1-carbonitrile;tungsten has a molecular weight of 308.05 g/mol, XLogP of 2.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-methylcyclobutane-1-carbonitrile;tungsten is sourced from PubChem (CID 178155727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).