C39H37F2N3O9S2 — CID 178156341
1-[3,5-difluoro-4-[2-(2-prop-2-ynoxyethoxy)ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione (PubChem CID 178156341) has the molecular formula C39H37F2N3O9S2 and a molecular weight of 793.87 g/mol. Its IUPAC name is 1-[3,5-difluoro-4-[2-(2-prop-2-ynoxyethoxy)ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione.
| Compound Name | 1-[3,5-difluoro-4-[2-(2-prop-2-ynoxyethoxy)ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 178156341 |
| Molecular Formula | C39H37F2N3O9S2 |
| Molecular Weight | 793.87 g/mol |
| Exact Mass | 793.19 |
| IUPAC Name | 1-[3,5-difluoro-4-[2-(2-prop-2-ynoxyethoxy)ethoxy]phenyl]-3,4-bis[[4-(morpholine-4-carbonyl)phenyl]sulfanyl]pyrrole-2,5-dione |
| SMILES | C#CCOCCOCCOc1c(F)cc(N2C(=O)C(Sc3ccc(C(=O)N4CCOCC4)cc3)=C(Sc3ccc(C(=O)N4CCOCC4)cc3)C2=O)cc1F |
| InChI | InChI=1S/C39H37F2N3O9S2/c1-2-15-49-20-21-52-22-23-53-33-31(40)24-28(25-32(33)41)44-38(47)34(54-29-7-3-26(4-8-29)36(45)42-11-16-50-17-12-42)35(39(44)48)55-30-9-5-27(6-10-30)37(46)43-13-18-51-19-14-43/h1,3-10,24-25H,11-23H2 |
| InChIKey | FWSVQLSFROTPJI-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 124.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 793.87 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|