About 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one
1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one (PubChem CID 178156444) has the molecular formula C20H21FN4O
and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one.
Molecular Properties
| Compound Name | 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one |
| PubChem CID | 178156444 |
| Molecular Formula | C20H21FN4O |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one |
| SMILES | CC1=C2N=C(c3ccc(F)cc3)C=C(N3CCC(=O)CC3)N2N=CCC1 |
| InChI | InChI=1S/C20H21FN4O/c1-14-3-2-10-22-25-19(24-11-8-17(26)9-12-24)13-18(23-20(14)25)15-4-6-16(21)7-5-15/h4-7,10,13H,2-3,8-9,11-12H2,1H3 |
| InChIKey | SAAAWQYNVPQIKG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 48.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one?
The IUPAC name of 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one (CID 178156444) is 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one.
What is the SMILES notation for 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one?
The canonical SMILES for 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one is CC1=C2N=C(c3ccc(F)cc3)C=C(N3CCC(=O)CC3)N2N=CCC1.
What is the InChIKey of 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one?
The InChIKey is SAAAWQYNVPQIKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21FN4O/c1-14-3-2-10-22-25-19(24-11-8-17(26)9-12-24)13-18(23-20(14)25)15-4-6-16(21)7-5-15/h4-7,10,13H,2-3,8-9,11-12H2,1H3.
What are the key properties of 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one?
1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one has a molecular weight of 352.41 g/mol, XLogP of 3.45, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(4-fluorophenyl)-10-methyl-8,9-dihydropyrimido[1,2-b]diazepin-4-yl]piperidin-4-one is sourced from PubChem (CID 178156444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).