C20H20FN3 — CID 178156473
11-cyclohexyl-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene (PubChem CID 178156473) has the molecular formula C20H20FN3 and a molecular weight of 321.40 g/mol. Its IUPAC name is 11-cyclohexyl-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene.
| Compound Name | 11-cyclohexyl-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
|---|---|
| PubChem CID | 178156473 |
| Molecular Formula | C20H20FN3 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 11-cyclohexyl-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
| SMILES | Fc1ccc(C2=NC3=C=CCC=NN3C(C3CCCCC3)=C2)cc1 |
| InChI | InChI=1S/C20H20FN3/c21-17-11-9-15(10-12-17)18-14-19(16-6-2-1-3-7-16)24-20(23-18)8-4-5-13-22-24/h4,9-14,16H,1-3,5-7H2 |
| InChIKey | BMQKLDLKHHRXPN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |