C21H26FN5 — CID 178156590
11-(4-ethyl-2-methylpiperazin-1-yl)-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene;molecular hydrogen (PubChem CID 178156590) has the molecular formula C21H26FN5 and a molecular weight of 367.47 g/mol. Its IUPAC name is 11-(4-ethyl-2-methylpiperazin-1-yl)-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene;molecular hydrogen.
| Compound Name | 11-(4-ethyl-2-methylpiperazin-1-yl)-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene;molecular hydrogen |
|---|---|
| PubChem CID | 178156590 |
| Molecular Formula | C21H26FN5 |
| Molecular Weight | 367.47 g/mol |
| Exact Mass | 367.22 |
| IUPAC Name | 11-(4-ethyl-2-methylpiperazin-1-yl)-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene;molecular hydrogen |
| SMILES | CCN1CCN(C2=CC(c3ccc(F)cc3)=NC3=C=CCC=NN32)C(C)C1.[H][H] |
| InChI | InChI=1S/C21H24FN5.H2/c1-3-25-12-13-26(16(2)15-25)21-14-19(17-7-9-18(22)10-8-17)24-20-6-4-5-11-23-27(20)21;/h4,7-11,14,16H,3,5,12-13,15H2,1-2H3;1H |
| InChIKey | MNFWZJXQCCFVGY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.47 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |