C21H24FN5 — CID 178156591
11-(4-ethyl-2-methylpiperazin-1-yl)-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene (PubChem CID 178156591) has the molecular formula C21H24FN5 and a molecular weight of 365.46 g/mol. Its IUPAC name is 11-(4-ethyl-2-methylpiperazin-1-yl)-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene.
| Compound Name | 11-(4-ethyl-2-methylpiperazin-1-yl)-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
|---|---|
| PubChem CID | 178156591 |
| Molecular Formula | C21H24FN5 |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 11-(4-ethyl-2-methylpiperazin-1-yl)-9-(4-fluorophenyl)-1,2,8-triazabicyclo[5.4.0]undeca-2,5,6,8,10-pentaene |
| SMILES | CCN1CCN(C2=CC(c3ccc(F)cc3)=NC3=C=CCC=NN32)C(C)C1 |
| InChI | InChI=1S/C21H24FN5/c1-3-25-12-13-26(16(2)15-25)21-14-19(17-7-9-18(22)10-8-17)24-20-6-4-5-11-23-27(20)21/h4,7-11,14,16H,3,5,12-13,15H2,1-2H3 |
| InChIKey | SHQDRCJMFNRQNM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 34.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |