About 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine
1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine (PubChem CID 178156631) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine.
Molecular Properties
| Compound Name | 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine |
| PubChem CID | 178156631 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine |
| SMILES | [H]/N=C/n1c(C)c(C)c(C)n/c1=N\[H] |
| InChI | InChI=1S/C8H12N4/c1-5-6(2)11-8(10)12(4-9)7(5)3/h4,9-10H,1-3H3/b9-4+,10-8+ |
| InChIKey | IHPMTMCBTMJCIA-JKHSSWLHSA-N |
| XLogP | 0.74 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine?
The IUPAC name of 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine (CID 178156631) is 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine.
What is the SMILES notation for 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine?
The canonical SMILES for 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine is [H]/N=C/n1c(C)c(C)c(C)n/c1=N\[H].
What is the InChIKey of 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine?
The InChIKey is IHPMTMCBTMJCIA-JKHSSWLHSA-N. The full InChI is InChI=1S/C8H12N4/c1-5-6(2)11-8(10)12(4-9)7(5)3/h4,9-10H,1-3H3/b9-4+,10-8+.
What are the key properties of 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine?
1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine has a molecular weight of 164.21 g/mol, XLogP of 0.74, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methanimidoyl-4,5,6-trimethylpyrimidin-2-imine is sourced from PubChem (CID 178156631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).