C22H21F2N5O — CID 178157004
N-(3,3-difluorocyclobutyl)-1-[4-(8-oxa-3,4,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2,5,10,12-pentaen-4-yl)phenyl]azetidin-3-amine (PubChem CID 178157004) has the molecular formula C22H21F2N5O and a molecular weight of 409.44 g/mol. Its IUPAC name is N-(3,3-difluorocyclobutyl)-1-[4-(8-oxa-3,4,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2,5,10,12-pentaen-4-yl)phenyl]azetidin-3-amine.
| Compound Name | N-(3,3-difluorocyclobutyl)-1-[4-(8-oxa-3,4,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2,5,10,12-pentaen-4-yl)phenyl]azetidin-3-amine |
|---|---|
| PubChem CID | 178157004 |
| Molecular Formula | C22H21F2N5O |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-(3,3-difluorocyclobutyl)-1-[4-(8-oxa-3,4,10-triazatricyclo[7.4.0.02,6]trideca-1(9),2,5,10,12-pentaen-4-yl)phenyl]azetidin-3-amine |
| SMILES | FC1(F)CC(NC2CN(c3ccc(-n4cc5c(n4)-c4cccnc4OC5)cc3)C2)C1 |
| InChI | InChI=1S/C22H21F2N5O/c23-22(24)8-15(9-22)26-16-11-28(12-16)17-3-5-18(6-4-17)29-10-14-13-30-21-19(20(14)27-29)2-1-7-25-21/h1-7,10,15-16,26H,8-9,11-13H2 |
| InChIKey | HJHHLVXYUIXFSQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|