About 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine
4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine (PubChem CID 178157355) has the molecular formula C8H8BrClN2O
and a molecular weight of 263.52 g/mol. Its IUPAC name is 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine.
Molecular Properties
| Compound Name | 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine |
| PubChem CID | 178157355 |
| Molecular Formula | C8H8BrClN2O |
| Molecular Weight | 263.52 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine |
| SMILES | Nc1c(Cl)nc2c(c1Br)COCC2 |
| InChI | InChI=1S/C8H8BrClN2O/c9-6-4-3-13-2-1-5(4)12-8(10)7(6)11/h1-3,11H2 |
| InChIKey | HFVHOLDCSJWNAR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.52 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine?
The IUPAC name of 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine (CID 178157355) is 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine.
What is the SMILES notation for 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine?
The canonical SMILES for 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine is Nc1c(Cl)nc2c(c1Br)COCC2.
What is the InChIKey of 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine?
The InChIKey is HFVHOLDCSJWNAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8BrClN2O/c9-6-4-3-13-2-1-5(4)12-8(10)7(6)11/h1-3,11H2.
What are the key properties of 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine?
4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine has a molecular weight of 263.52 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-chloro-7,8-dihydro-5H-pyrano[4,3-b]pyridin-3-amine is sourced from PubChem (CID 178157355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).