C8H8BrClN2O — CID 178157365
7-bromo-6-chloro-4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine (PubChem CID 178157365) has the molecular formula C8H8BrClN2O and a molecular weight of 263.52 g/mol. Its IUPAC name is 7-bromo-6-chloro-4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine.
| Compound Name | 7-bromo-6-chloro-4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine |
|---|---|
| PubChem CID | 178157365 |
| Molecular Formula | C8H8BrClN2O |
| Molecular Weight | 263.52 g/mol |
| Exact Mass | 261.95 |
| IUPAC Name | 7-bromo-6-chloro-4-methyl-2,3-dihydropyrido[3,2-b][1,4]oxazine |
| SMILES | CN1CCOc2cc(Br)c(Cl)nc21 |
| InChI | InChI=1S/C8H8BrClN2O/c1-12-2-3-13-6-4-5(9)7(10)11-8(6)12/h4H,2-3H2,1H3 |
| InChIKey | OHBREQHLPUDPBC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|