C24H26N6O2 — CID 178157713
N-[3-cyclopentyl-1-oxo-1-(pyrimidin-5-ylamino)propan-2-yl]-3-(pyridin-4-ylamino)benzamide (PubChem CID 178157713) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is N-[3-cyclopentyl-1-oxo-1-(pyrimidin-5-ylamino)propan-2-yl]-3-(pyridin-4-ylamino)benzamide.
| Compound Name | N-[3-cyclopentyl-1-oxo-1-(pyrimidin-5-ylamino)propan-2-yl]-3-(pyridin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 178157713 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | N-[3-cyclopentyl-1-oxo-1-(pyrimidin-5-ylamino)propan-2-yl]-3-(pyridin-4-ylamino)benzamide |
| SMILES | O=C(NC(CC1CCCC1)C(=O)Nc1cncnc1)c1cccc(Nc2ccncc2)c1 |
| InChI | InChI=1S/C24H26N6O2/c31-23(18-6-3-7-20(13-18)28-19-8-10-25-11-9-19)30-22(12-17-4-1-2-5-17)24(32)29-21-14-26-16-27-15-21/h3,6-11,13-17,22H,1-2,4-5,12H2,(H,25,28)(H,29,32)(H,30,31) |
| InChIKey | OZADPSZLNHFGEN-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 108.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |