C25H29BrF2N4O3S — CID 178158087
5-[(7-bromo-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl)methyl]-N-[(2S)-3-cyclopentyl-1-[(3,3-difluorocyclobutyl)amino]-1-oxopropan-2-yl]thiophene-2-carboxamide (PubChem CID 178158087) has the molecular formula C25H29BrF2N4O3S and a molecular weight of 583.50 g/mol. Its IUPAC name is 5-[(7-bromo-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl)methyl]-N-[(2S)-3-cyclopentyl-1-[(3,3-difluorocyclobutyl)amino]-1-oxopropan-2-yl]thiophene-2-carboxamide.
| Compound Name | 5-[(7-bromo-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl)methyl]-N-[(2S)-3-cyclopentyl-1-[(3,3-difluorocyclobutyl)amino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 178158087 |
| Molecular Formula | C25H29BrF2N4O3S |
| Molecular Weight | 583.50 g/mol |
| Exact Mass | 582.11 |
| IUPAC Name | 5-[(7-bromo-2,3-dihydropyrido[2,3-b][1,4]oxazin-1-yl)methyl]-N-[(2S)-3-cyclopentyl-1-[(3,3-difluorocyclobutyl)amino]-1-oxopropan-2-yl]thiophene-2-carboxamide |
| SMILES | O=C(N[C@@H](CC1CCCC1)C(=O)NC1CC(F)(F)C1)c1ccc(CN2CCOc3ncc(Br)cc32)s1 |
| InChI | InChI=1S/C25H29BrF2N4O3S/c26-16-10-20-24(29-13-16)35-8-7-32(20)14-18-5-6-21(36-18)23(34)31-19(9-15-3-1-2-4-15)22(33)30-17-11-25(27,28)12-17/h5-6,10,13,15,17,19H,1-4,7-9,11-12,14H2,(H,30,33)(H,31,34)/t19-/m0/s1 |
| InChIKey | SXVWSRGEVBXGCQ-IBGZPJMESA-N |
| XLogP | 4.90 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |