C12H11N3O2 — CID 178158663
(12E)-2,5,8-triazatricyclo[7.6.0.03,7]pentadeca-1(9),2,7,12-tetraene-4,6-dione (PubChem CID 178158663) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is (12E)-2,5,8-triazatricyclo[7.6.0.03,7]pentadeca-1(9),2,7,12-tetraene-4,6-dione.
| Compound Name | (12E)-2,5,8-triazatricyclo[7.6.0.03,7]pentadeca-1(9),2,7,12-tetraene-4,6-dione |
|---|---|
| PubChem CID | 178158663 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | (12E)-2,5,8-triazatricyclo[7.6.0.03,7]pentadeca-1(9),2,7,12-tetraene-4,6-dione |
| SMILES | O=C1NC(=O)c2nc3c(nc21)CC/C=C\CC3 |
| InChI | InChI=1S/C12H11N3O2/c16-11-9-10(12(17)15-11)14-8-6-4-2-1-3-5-7(8)13-9/h1-2H,3-6H2,(H,15,16,17)/b2-1- |
| InChIKey | DBQRFYDAJACDSS-UPHRSURJSA-N |
| XLogP | 0.80 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|