C18H19N7S — CID 178158789
5-[(1S,2S)-2-[5-(3,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1-methylpyrazol-3-yl]cyclopropyl]-2-methyl-1,3-thiazole (PubChem CID 178158789) has the molecular formula C18H19N7S and a molecular weight of 365.47 g/mol. Its IUPAC name is 5-[(1S,2S)-2-[5-(3,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1-methylpyrazol-3-yl]cyclopropyl]-2-methyl-1,3-thiazole.
| Compound Name | 5-[(1S,2S)-2-[5-(3,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1-methylpyrazol-3-yl]cyclopropyl]-2-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 178158789 |
| Molecular Formula | C18H19N7S |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 5-[(1S,2S)-2-[5-(3,8-dimethyl-[1,2,4]triazolo[4,3-b]pyridazin-6-yl)-1-methylpyrazol-3-yl]cyclopropyl]-2-methyl-1,3-thiazole |
| SMILES | Cc1ncc([C@H]2C[C@@H]2c2cc(-c3cc(C)c4nnc(C)n4n3)n(C)n2)s1 |
| InChI | InChI=1S/C18H19N7S/c1-9-5-15(23-25-10(2)20-21-18(9)25)16-7-14(22-24(16)4)12-6-13(12)17-8-19-11(3)26-17/h5,7-8,12-13H,6H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | HUASGVHFKVCVJH-STQMWFEESA-N |
| XLogP | 3.18 |
| TPSA | 73.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |