C10H18O2 — CID 178159874
(2S)-2-[(1S,3R)-3-methylcyclohexyl]propanoic acid (PubChem CID 178159874) has the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. Its IUPAC name is (2S)-2-[(1S,3R)-3-methylcyclohexyl]propanoic acid.
| Compound Name | (2S)-2-[(1S,3R)-3-methylcyclohexyl]propanoic acid |
|---|---|
| PubChem CID | 178159874 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (2S)-2-[(1S,3R)-3-methylcyclohexyl]propanoic acid |
| SMILES | C[C@@H]1CCC[C@H]([C@H](C)C(=O)O)C1 |
| InChI | InChI=1S/C10H18O2/c1-7-4-3-5-9(6-7)8(2)10(11)12/h7-9H,3-6H2,1-2H3,(H,11,12)/t7-,8+,9+/m1/s1 |
| InChIKey | BGPAVAOBLHLBRB-VGMNWLOBSA-N |
| XLogP | 2.53 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |