C5H9IN3- — CID 178160647
1-ethyl-5-methyliodanuidyl-1,2,4-triazole (PubChem CID 178160647) has the molecular formula C5H9IN3- and a molecular weight of 238.05 g/mol. Its IUPAC name is 1-ethyl-5-methyliodanuidyl-1,2,4-triazole.
| Compound Name | 1-ethyl-5-methyliodanuidyl-1,2,4-triazole |
|---|---|
| PubChem CID | 178160647 |
| Molecular Formula | C5H9IN3- |
| Molecular Weight | 238.05 g/mol |
| Exact Mass | 237.98 |
| IUPAC Name | 1-ethyl-5-methyliodanuidyl-1,2,4-triazole |
| SMILES | CCn1ncnc1[I-]C |
| InChI | InChI=1S/C5H9IN3/c1-3-9-5(6-2)7-4-8-9/h4H,3H2,1-2H3/q-1 |
| InChIKey | WKEWIMQBVNDOHC-UHFFFAOYSA-N |
| XLogP | -2.81 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.05 |
| LogP ≤ 5 | -2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|