C14H16ClFN4O — CID 178160956
(8S,10R)-13-chloro-14-fluoro-10-methyl-6-oxa-2,12,16,17-tetrazatetracyclo[9.6.1.02,8.015,18]octadeca-1(17),11,13,15(18)-tetraene (PubChem CID 178160956) has the molecular formula C14H16ClFN4O and a molecular weight of 310.76 g/mol. Its IUPAC name is (8S,10R)-13-chloro-14-fluoro-10-methyl-6-oxa-2,12,16,17-tetrazatetracyclo[9.6.1.02,8.015,18]octadeca-1(17),11,13,15(18)-tetraene.
| Compound Name | (8S,10R)-13-chloro-14-fluoro-10-methyl-6-oxa-2,12,16,17-tetrazatetracyclo[9.6.1.02,8.015,18]octadeca-1(17),11,13,15(18)-tetraene |
|---|---|
| PubChem CID | 178160956 |
| Molecular Formula | C14H16ClFN4O |
| Molecular Weight | 310.76 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (8S,10R)-13-chloro-14-fluoro-10-methyl-6-oxa-2,12,16,17-tetrazatetracyclo[9.6.1.02,8.015,18]octadeca-1(17),11,13,15(18)-tetraene |
| SMILES | C[C@@H]1C[C@H]2COCCCN2c2n[nH]c3c(F)c(Cl)nc1c23 |
| InChI | InChI=1S/C14H16ClFN4O/c1-7-5-8-6-21-4-2-3-20(8)14-9-11(7)17-13(15)10(16)12(9)18-19-14/h7-8H,2-6H2,1H3,(H,18,19)/t7-,8+/m1/s1 |
| InChIKey | GETCTTUEUXYJBT-SFYZADRCSA-N |
| XLogP | 2.85 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.76 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|