C24H34FN5O2 — CID 178161496
3-[4-[(4R)-3-fluoro-4-(piperidin-4-ylmethyl)piperidin-1-yl]-2-(methylamino)benzenecarboximidoyl]piperidine-2,6-dione (PubChem CID 178161496) has the molecular formula C24H34FN5O2 and a molecular weight of 443.57 g/mol. Its IUPAC name is 3-[4-[(4R)-3-fluoro-4-(piperidin-4-ylmethyl)piperidin-1-yl]-2-(methylamino)benzenecarboximidoyl]piperidine-2,6-dione.
| Compound Name | 3-[4-[(4R)-3-fluoro-4-(piperidin-4-ylmethyl)piperidin-1-yl]-2-(methylamino)benzenecarboximidoyl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 178161496 |
| Molecular Formula | C24H34FN5O2 |
| Molecular Weight | 443.57 g/mol |
| Exact Mass | 443.27 |
| IUPAC Name | 3-[4-[(4R)-3-fluoro-4-(piperidin-4-ylmethyl)piperidin-1-yl]-2-(methylamino)benzenecarboximidoyl]piperidine-2,6-dione |
| SMILES | [H]/N=C(/c1ccc(N2CC[C@@H](CC3CCNCC3)C(F)C2)cc1NC)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C24H34FN5O2/c1-27-21-13-17(2-3-18(21)23(26)19-4-5-22(31)29-24(19)32)30-11-8-16(20(25)14-30)12-15-6-9-28-10-7-15/h2-3,13,15-16,19-20,26-28H,4-12,14H2,1H3,(H,29,31,32)/b26-23-/t16-,19?,20?/m0/s1 |
| InChIKey | TWSWMFAJBCYKNP-GZFRANNKSA-N |
| XLogP | 2.70 |
| TPSA | 97.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|