About 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one
3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one (PubChem CID 178161960) has the molecular formula C22H22F3N3O2
and a molecular weight of 417.43 g/mol. Its IUPAC name is 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one.
Molecular Properties
| Compound Name | 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one |
| PubChem CID | 178161960 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one |
| SMILES | C#CCCC(N)(N)CCC1(c2ccc(O)cc2)C(=O)Nc2c(C(F)(F)F)cccc21 |
| InChI | InChI=1S/C22H22F3N3O2/c1-2-3-11-20(26,27)12-13-21(14-7-9-15(29)10-8-14)16-5-4-6-17(22(23,24)25)18(16)28-19(21)30/h1,4-10,29H,3,11-13,26-27H2,(H,28,30) |
| InChIKey | LPARLFKMBISYNV-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one?
The IUPAC name of 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one (CID 178161960) is 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one.
What is the SMILES notation for 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one?
The canonical SMILES for 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one is C#CCCC(N)(N)CCC1(c2ccc(O)cc2)C(=O)Nc2c(C(F)(F)F)cccc21.
What is the InChIKey of 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one?
The InChIKey is LPARLFKMBISYNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F3N3O2/c1-2-3-11-20(26,27)12-13-21(14-7-9-15(29)10-8-14)16-5-4-6-17(22(23,24)25)18(16)28-19(21)30/h1,4-10,29H,3,11-13,26-27H2,(H,28,30).
What are the key properties of 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one?
3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one has a molecular weight of 417.43 g/mol, XLogP of 3.46, 6 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-diaminohept-6-ynyl)-3-(4-hydroxyphenyl)-7-(trifluoromethyl)-1H-indol-2-one is sourced from PubChem (CID 178161960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).