C25H47N3O4 — CID 178163439
[(2E)-cyclooct-2-en-1-yl] N-[3-[[4-(ethylamino)-6-methyl-5-oxooctanoyl]amino]propyl]carbamate;ethane (PubChem CID 178163439) has the molecular formula C25H47N3O4 and a molecular weight of 453.67 g/mol. Its IUPAC name is [(2E)-cyclooct-2-en-1-yl] N-[3-[[4-(ethylamino)-6-methyl-5-oxooctanoyl]amino]propyl]carbamate;ethane.
| Compound Name | [(2E)-cyclooct-2-en-1-yl] N-[3-[[4-(ethylamino)-6-methyl-5-oxooctanoyl]amino]propyl]carbamate;ethane |
|---|---|
| PubChem CID | 178163439 |
| Molecular Formula | C25H47N3O4 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.36 |
| IUPAC Name | [(2E)-cyclooct-2-en-1-yl] N-[3-[[4-(ethylamino)-6-methyl-5-oxooctanoyl]amino]propyl]carbamate;ethane |
| SMILES | CC.CCNC(CCC(=O)NCCCNC(=O)OC1/C=C\CCCCC1)C(=O)C(C)CC |
| InChI | InChI=1S/C23H41N3O4.C2H6/c1-4-18(3)22(28)20(24-5-2)14-15-21(27)25-16-11-17-26-23(29)30-19-12-9-7-6-8-10-13-19;1-2/h9,12,18-20,24H,4-8,10-11,13-17H2,1-3H3,(H,25,27)(H,26,29);1-2H3/b12-9-; |
| InChIKey | CDXAJYYFPWXALC-MWMYENNMSA-N |
| XLogP | 4.51 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|