About (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol
(3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol (PubChem CID 178163721) has the molecular formula C5H6BrFO
and a molecular weight of 181.00 g/mol. Its IUPAC name is (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol.
Molecular Properties
| Compound Name | (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol |
| PubChem CID | 178163721 |
| Molecular Formula | C5H6BrFO |
| Molecular Weight | 181.00 g/mol |
| Exact Mass | 179.96 |
| IUPAC Name | (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol |
| SMILES | C=C(F)/C(O)=C(\C)Br |
| InChI | InChI=1S/C5H6BrFO/c1-3(6)5(8)4(2)7/h8H,2H2,1H3/b5-3- |
| InChIKey | MJNTWVSGYKNCIP-HYXAFXHYSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.00 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol?
The IUPAC name of (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol (CID 178163721) is (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol.
What is the SMILES notation for (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol?
The canonical SMILES for (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol is C=C(F)/C(O)=C(\C)Br.
What is the InChIKey of (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol?
The InChIKey is MJNTWVSGYKNCIP-HYXAFXHYSA-N. The full InChI is InChI=1S/C5H6BrFO/c1-3(6)5(8)4(2)7/h8H,2H2,1H3/b5-3-.
What are the key properties of (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol?
(3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol has a molecular weight of 181.00 g/mol, XLogP of 2.65, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-bromo-2-fluoropenta-1,3-dien-3-ol is sourced from PubChem (CID 178163721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).