About CID 178164197
CID 178164197 (PubChem CID 178164197) has the molecular formula C31H36F2N7O4S+
and a molecular weight of 640.74 g/mol.
Molecular Properties
| Compound Name | CID 178164197 |
| PubChem CID | 178164197 |
| Molecular Formula | C31H36F2N7O4S+ |
| Molecular Weight | 640.74 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | — |
| SMILES | [H]/N=C(/c1ccc(N2CCN(Cc3cccc([S+](=O)(O)c4ccc(N)c(F)c4)c3)C(C)(C)C2)c(F)c1NC)N1CCC(=O)NC1=O |
| InChI | InChI=1S/C31H35F2N7O4S/c1-31(2)18-38(25-10-8-22(28(36-3)27(25)33)29(35)40-12-11-26(41)37-30(40)42)13-14-39(31)17-19-5-4-6-20(15-19)45(43,44)21-7-9-24(34)23(32)16-21/h4-10,15-16H,11-14,17-18H2,1-3H3,(H5-,34,35,36,37,41,42,43,44)/p+1 |
| InChIKey | AOCKKHKBTWMKFF-UHFFFAOYSA-O |
| XLogP | 4.35 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 640.74 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze CID 178164197 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 178164197?
The IUPAC name of CID 178164197 (CID 178164197) is not available.
What is the SMILES notation for CID 178164197?
The canonical SMILES for CID 178164197 is [H]/N=C(/c1ccc(N2CCN(Cc3cccc([S+](=O)(O)c4ccc(N)c(F)c4)c3)C(C)(C)C2)c(F)c1NC)N1CCC(=O)NC1=O.
What is the InChIKey of CID 178164197?
The InChIKey is AOCKKHKBTWMKFF-UHFFFAOYSA-O. The full InChI is InChI=1S/C31H35F2N7O4S/c1-31(2)18-38(25-10-8-22(28(36-3)27(25)33)29(35)40-12-11-26(41)37-30(40)42)13-14-39(31)17-19-5-4-6-20(15-19)45(43,44)21-7-9-24(34)23(32)16-21/h4-10,15-16H,11-14,17-18H2,1-3H3,(H5-,34,35,36,37,41,42,43,44)/p+1.
What are the key properties of CID 178164197?
CID 178164197 has a molecular weight of 640.74 g/mol, XLogP of 4.35, 7 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for CID 178164197 is sourced from PubChem (CID 178164197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).