C44H58BF2N13O4S — CID 178164229
CID 178164229 (PubChem CID 178164229) has the molecular formula C44H58BF2N13O4S and a molecular weight of 913.91 g/mol.
| Compound Name | CID 178164229 |
|---|---|
| PubChem CID | 178164229 |
| Molecular Formula | C44H58BF2N13O4S |
| Molecular Weight | 913.91 g/mol |
| Exact Mass | 913.45 |
| IUPAC Name | — |
| SMILES | C=CNCCC=O.CC.[B]C(O)(C1CCCN(S(=O)c2ccc(Nc3nc4c(OC(C)C)c(-c5cn[nH]c5)ncn4n3)c(F)c2)C1)N1CCC(c2ccc3c(NC)nn(C)c3c2F)CC1 |
| InChI | InChI=1S/C37H43BF2N12O3S.C5H9NO.C2H6/c1-21(2)55-33-31(23-17-43-44-18-23)42-20-52-35(33)46-36(48-52)45-29-10-7-25(16-28(29)39)56(54)51-13-5-6-24(19-51)37(38,53)50-14-11-22(12-15-50)26-8-9-27-32(30(26)40)49(4)47-34(27)41-3;1-2-6-4-3-5-7;1-2/h7-10,16-18,20-22,24,53H,5-6,11-15,19H2,1-4H3,(H,41,47)(H,43,44)(H,45,48);2,5-6H,1,3-4H2;1-2H3 |
| InChIKey | FIQYROAYJZATGN-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 195.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 65 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 913.91 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|