C43H44F2N6O2 — CID 178164597
3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-[4-[3,3-difluoro-1-(4-methylphenyl)piperidin-4-yl]piperazin-1-yl]-1-methylindazole (PubChem CID 178164597) has the molecular formula C43H44F2N6O2 and a molecular weight of 714.86 g/mol. Its IUPAC name is 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-[4-[3,3-difluoro-1-(4-methylphenyl)piperidin-4-yl]piperazin-1-yl]-1-methylindazole.
| Compound Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-[4-[3,3-difluoro-1-(4-methylphenyl)piperidin-4-yl]piperazin-1-yl]-1-methylindazole |
|---|---|
| PubChem CID | 178164597 |
| Molecular Formula | C43H44F2N6O2 |
| Molecular Weight | 714.86 g/mol |
| Exact Mass | 714.35 |
| IUPAC Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-[4-[3,3-difluoro-1-(4-methylphenyl)piperidin-4-yl]piperazin-1-yl]-1-methylindazole |
| SMILES | Cc1ccc(N2CCC(N3CCN(c4cccc5c(-c6ccc(OCc7ccccc7)nc6OCc6ccccc6)nn(C)c45)CC3)C(F)(F)C2)cc1 |
| InChI | InChI=1S/C43H44F2N6O2/c1-31-16-18-34(19-17-31)51-23-22-38(43(44,45)30-51)50-26-24-49(25-27-50)37-15-9-14-35-40(47-48(2)41(35)37)36-20-21-39(52-28-32-10-5-3-6-11-32)46-42(36)53-29-33-12-7-4-8-13-33/h3-21,38H,22-30H2,1-2H3 |
| InChIKey | XWHLXCBTCRARJH-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 58.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.86 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|