About 3-(3,3-difluorocyclobutylidene)pyrrolidine
3-(3,3-difluorocyclobutylidene)pyrrolidine (PubChem CID 178165372) has the molecular formula C8H11F2N
and a molecular weight of 159.18 g/mol. Its IUPAC name is 3-(3,3-difluorocyclobutylidene)pyrrolidine.
Molecular Properties
| Compound Name | 3-(3,3-difluorocyclobutylidene)pyrrolidine |
| PubChem CID | 178165372 |
| Molecular Formula | C8H11F2N |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | 3-(3,3-difluorocyclobutylidene)pyrrolidine |
| SMILES | FC1(F)CC(=C2CCNC2)C1 |
| InChI | InChI=1S/C8H11F2N/c9-8(10)3-7(4-8)6-1-2-11-5-6/h11H,1-5H2 |
| InChIKey | MTJQHNUIGMGGPZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(3,3-difluorocyclobutylidene)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3,3-difluorocyclobutylidene)pyrrolidine?
The IUPAC name of 3-(3,3-difluorocyclobutylidene)pyrrolidine (CID 178165372) is 3-(3,3-difluorocyclobutylidene)pyrrolidine.
What is the SMILES notation for 3-(3,3-difluorocyclobutylidene)pyrrolidine?
The canonical SMILES for 3-(3,3-difluorocyclobutylidene)pyrrolidine is FC1(F)CC(=C2CCNC2)C1.
What is the InChIKey of 3-(3,3-difluorocyclobutylidene)pyrrolidine?
The InChIKey is MTJQHNUIGMGGPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N/c9-8(10)3-7(4-8)6-1-2-11-5-6/h11H,1-5H2.
What are the key properties of 3-(3,3-difluorocyclobutylidene)pyrrolidine?
3-(3,3-difluorocyclobutylidene)pyrrolidine has a molecular weight of 159.18 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3,3-difluorocyclobutylidene)pyrrolidine is sourced from PubChem (CID 178165372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).