About 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane
1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane (PubChem CID 178166150) has the molecular formula C15H21F3N2O3
and a molecular weight of 334.34 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane.
Molecular Properties
| Compound Name | 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane |
| PubChem CID | 178166150 |
| Molecular Formula | C15H21F3N2O3 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane |
| SMILES | CCOCCn1cc(C(N)=O)ccc1=O.FC(F)(F)C1CCC1 |
| InChI | InChI=1S/C10H14N2O3.C5H7F3/c1-2-15-6-5-12-7-8(10(11)14)3-4-9(12)13;6-5(7,8)4-2-1-3-4/h3-4,7H,2,5-6H2,1H3,(H2,11,14);4H,1-3H2 |
| InChIKey | LSTKMKUYGCIVBN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane?
The IUPAC name of 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane (CID 178166150) is 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane.
What is the SMILES notation for 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane?
The canonical SMILES for 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane is CCOCCn1cc(C(N)=O)ccc1=O.FC(F)(F)C1CCC1.
What is the InChIKey of 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane?
The InChIKey is LSTKMKUYGCIVBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O3.C5H7F3/c1-2-15-6-5-12-7-8(10(11)14)3-4-9(12)13;6-5(7,8)4-2-1-3-4/h3-4,7H,2,5-6H2,1H3,(H2,11,14);4H,1-3H2.
What are the key properties of 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane?
1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane has a molecular weight of 334.34 g/mol, XLogP of 2.33, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;trifluoromethylcyclobutane is sourced from PubChem (CID 178166150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).