C16H23F3N2O3 — CID 178166301
1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;2,2,2-trifluoroethylcyclobutane (PubChem CID 178166301) has the molecular formula C16H23F3N2O3 and a molecular weight of 348.37 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;2,2,2-trifluoroethylcyclobutane.
| Compound Name | 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;2,2,2-trifluoroethylcyclobutane |
|---|---|
| PubChem CID | 178166301 |
| Molecular Formula | C16H23F3N2O3 |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 1-(2-ethoxyethyl)-6-oxopyridine-3-carboxamide;2,2,2-trifluoroethylcyclobutane |
| SMILES | CCOCCn1cc(C(N)=O)ccc1=O.FC(F)(F)CC1CCC1 |
| InChI | InChI=1S/C10H14N2O3.C6H9F3/c1-2-15-6-5-12-7-8(10(11)14)3-4-9(12)13;7-6(8,9)4-5-2-1-3-5/h3-4,7H,2,5-6H2,1H3,(H2,11,14);5H,1-4H2 |
| InChIKey | LUDWJSWGMCNBNE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|