C9H15NO2 — CID 178169062
5,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrol-8-ylmethanol (PubChem CID 178169062) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is 5,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrol-8-ylmethanol.
| Compound Name | 5,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrol-8-ylmethanol |
|---|---|
| PubChem CID | 178169062 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | 5,5a,6,7,8,8a-hexahydro-2H-oxepino[2,3-c]pyrrol-8-ylmethanol |
| SMILES | OCC1NCC2CC=CCOC21 |
| InChI | InChI=1S/C9H15NO2/c11-6-8-9-7(5-10-8)3-1-2-4-12-9/h1-2,7-11H,3-6H2 |
| InChIKey | XYXCGSALFHOCBD-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|