About 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole
2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole (PubChem CID 178169613) has the molecular formula C12H18F2N2S
and a molecular weight of 260.35 g/mol. Its IUPAC name is 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole |
| PubChem CID | 178169613 |
| Molecular Formula | C12H18F2N2S |
| Molecular Weight | 260.35 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole |
| SMILES | CC(C)c1csc(CN2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C12H18F2N2S/c1-9(2)10-8-17-11(15-10)7-16-5-3-12(13,14)4-6-16/h8-9H,3-7H2,1-2H3 |
| InChIKey | NQJPDMONHZHWLJ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.35 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole?
The IUPAC name of 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole (CID 178169613) is 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole.
What is the SMILES notation for 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole?
The canonical SMILES for 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole is CC(C)c1csc(CN2CCC(F)(F)CC2)n1.
What is the InChIKey of 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole?
The InChIKey is NQJPDMONHZHWLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N2S/c1-9(2)10-8-17-11(15-10)7-16-5-3-12(13,14)4-6-16/h8-9H,3-7H2,1-2H3.
What are the key properties of 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole?
2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole has a molecular weight of 260.35 g/mol, XLogP of 3.50, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,4-difluoropiperidin-1-yl)methyl]-4-propan-2-yl-1,3-thiazole is sourced from PubChem (CID 178169613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).