About 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole
3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole (PubChem CID 178169617) has the molecular formula C23H28N2
and a molecular weight of 332.49 g/mol. Its IUPAC name is 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole.
Molecular Properties
| Compound Name | 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole |
| PubChem CID | 178169617 |
| Molecular Formula | C23H28N2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.23 |
| IUPAC Name | 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole |
| SMILES | CC(C)c1ccc2[nH]ccc2c1.Cc1c[nH]c2ccc(C(C)C)cc12 |
| InChI | InChI=1S/C12H15N.C11H13N/c1-8(2)10-4-5-12-11(6-10)9(3)7-13-12;1-8(2)9-3-4-11-10(7-9)5-6-12-11/h4-8,13H,1-3H3;3-8,12H,1-2H3 |
| InChIKey | LKLAKJCYBUHXQL-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole?
The IUPAC name of 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole (CID 178169617) is 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole.
What is the SMILES notation for 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole?
The canonical SMILES for 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole is CC(C)c1ccc2[nH]ccc2c1.Cc1c[nH]c2ccc(C(C)C)cc12.
What is the InChIKey of 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole?
The InChIKey is LKLAKJCYBUHXQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C11H13N/c1-8(2)10-4-5-12-11(6-10)9(3)7-13-12;1-8(2)9-3-4-11-10(7-9)5-6-12-11/h4-8,13H,1-3H3;3-8,12H,1-2H3.
What are the key properties of 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole?
3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole has a molecular weight of 332.49 g/mol, XLogP of 6.89, 2 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-5-propan-2-yl-1H-indole;5-propan-2-yl-1H-indole is sourced from PubChem (CID 178169617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).