About ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine
ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine (PubChem CID 178170441) has the molecular formula C11H17NS
and a molecular weight of 195.33 g/mol. Its IUPAC name is ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine.
Molecular Properties
| Compound Name | ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine |
| PubChem CID | 178170441 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine |
| SMILES | CC.[H]/N=C1\C=C(CSC)C=CC1=C |
| InChI | InChI=1S/C9H11NS.C2H6/c1-7-3-4-8(6-11-2)5-9(7)10;1-2/h3-5,10H,1,6H2,2H3;1-2H3/b10-9+; |
| InChIKey | DIVLSMXJUXKEDO-RRABGKBLSA-N |
| XLogP | 3.45 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine?
The IUPAC name of ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine (CID 178170441) is ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine.
What is the SMILES notation for ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine?
The canonical SMILES for ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine is CC.[H]/N=C1\C=C(CSC)C=CC1=C.
What is the InChIKey of ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine?
The InChIKey is DIVLSMXJUXKEDO-RRABGKBLSA-N. The full InChI is InChI=1S/C9H11NS.C2H6/c1-7-3-4-8(6-11-2)5-9(7)10;1-2/h3-5,10H,1,6H2,2H3;1-2H3/b10-9+;.
What are the key properties of ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine?
ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine has a molecular weight of 195.33 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methylidene-3-(methylsulfanylmethyl)cyclohexa-2,4-dien-1-imine is sourced from PubChem (CID 178170441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).