About ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine
ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine (PubChem CID 178170525) has the molecular formula C11H28FN3
and a molecular weight of 221.36 g/mol. Its IUPAC name is ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine.
Molecular Properties
| Compound Name | ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine |
| PubChem CID | 178170525 |
| Molecular Formula | C11H28FN3 |
| Molecular Weight | 221.36 g/mol |
| Exact Mass | 221.23 |
| IUPAC Name | ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine |
| SMILES | CC.CC.CC(C)/N=C/NF.[H]/N=C/CC |
| InChI | InChI=1S/C4H9FN2.C3H7N.2C2H6/c1-4(2)6-3-7-5;1-2-3-4;2*1-2/h3-4H,1-2H3,(H,6,7);3-4H,2H2,1H3;2*1-2H3/b;4-3+;; |
| InChIKey | ZRLJQZFNNCXFCS-NXZCPFRHSA-N |
| XLogP | 4.00 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine?
The IUPAC name of ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine (CID 178170525) is ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine.
What is the SMILES notation for ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine?
The canonical SMILES for ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine is CC.CC.CC(C)/N=C/NF.[H]/N=C/CC.
What is the InChIKey of ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine?
The InChIKey is ZRLJQZFNNCXFCS-NXZCPFRHSA-N. The full InChI is InChI=1S/C4H9FN2.C3H7N.2C2H6/c1-4(2)6-3-7-5;1-2-3-4;2*1-2/h3-4H,1-2H3,(H,6,7);3-4H,2H2,1H3;2*1-2H3/b;4-3+;;.
What are the key properties of ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine?
ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine has a molecular weight of 221.36 g/mol, XLogP of 4.00, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-fluoro-N'-propan-2-ylmethanimidamide;propan-1-imine is sourced from PubChem (CID 178170525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).