About potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine
potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine (PubChem CID 178170617) has the molecular formula C12H24KNS-2
and a molecular weight of 253.50 g/mol. Its IUPAC name is potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine.
Molecular Properties
| Compound Name | potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine |
| PubChem CID | 178170617 |
| Molecular Formula | C12H24KNS-2 |
| Molecular Weight | 253.50 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine |
| SMILES | CS/C(C)=[C-]/CN1CCCCC1.[CH3-].[CH3-].[K+] |
| InChI | InChI=1S/C10H18NS.2CH3.K/c1-10(12-2)6-9-11-7-4-3-5-8-11;;;/h3-5,7-9H2,1-2H3;2*1H3;/q3*-1;+1 |
| InChIKey | WXXCONJPUDBBBS-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.50 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine?
The IUPAC name of potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine (CID 178170617) is potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine.
What is the SMILES notation for potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine?
The canonical SMILES for potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine is CS/C(C)=[C-]/CN1CCCCC1.[CH3-].[CH3-].[K+].
What is the InChIKey of potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine?
The InChIKey is WXXCONJPUDBBBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18NS.2CH3.K/c1-10(12-2)6-9-11-7-4-3-5-8-11;;;/h3-5,7-9H2,1-2H3;2*1H3;/q3*-1;+1.
What are the key properties of potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine?
potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine has a molecular weight of 253.50 g/mol, XLogP of 0.45, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;carbanide;1-(3-methylsulfanylbut-2-enyl)piperidine is sourced from PubChem (CID 178170617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).