About ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine
ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine (PubChem CID 178170687) has the molecular formula C11H21NO2
and a molecular weight of 199.29 g/mol. Its IUPAC name is ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine |
| PubChem CID | 178170687 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine |
| SMILES | C/C=C1/OCCO/C1=C/N(C)C.CC |
| InChI | InChI=1S/C9H15NO2.C2H6/c1-4-8-9(7-10(2)3)12-6-5-11-8;1-2/h4,7H,5-6H2,1-3H3;1-2H3/b8-4+,9-7+; |
| InChIKey | QEBHXBMXQYRVOK-RQRTXIBDSA-N |
| XLogP | 2.37 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine?
The IUPAC name of ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine (CID 178170687) is ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine.
What is the SMILES notation for ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine?
The canonical SMILES for ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine is C/C=C1/OCCO/C1=C/N(C)C.CC.
What is the InChIKey of ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine?
The InChIKey is QEBHXBMXQYRVOK-RQRTXIBDSA-N. The full InChI is InChI=1S/C9H15NO2.C2H6/c1-4-8-9(7-10(2)3)12-6-5-11-8;1-2/h4,7H,5-6H2,1-3H3;1-2H3/b8-4+,9-7+;.
What are the key properties of ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine?
ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine has a molecular weight of 199.29 g/mol, XLogP of 2.37, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1E)-1-[(3E)-3-ethylidene-1,4-dioxan-2-ylidene]-N,N-dimethylmethanamine is sourced from PubChem (CID 178170687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).