About (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine
(2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine (PubChem CID 178170714) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine.
Molecular Properties
| Compound Name | (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine |
| PubChem CID | 178170714 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine |
| SMILES | [H]/N=C(\C=C(\C)N)C(=C)N1CCC(CC)C1 |
| InChI | InChI=1S/C12H21N3/c1-4-11-5-6-15(8-11)10(3)12(14)7-9(2)13/h7,11,14H,3-6,8,13H2,1-2H3/b9-7-,14-12+ |
| InChIKey | ODCXUTMXFJHAMC-LTPFSSFFSA-N |
| XLogP | 2.11 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine?
The IUPAC name of (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine (CID 178170714) is (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine.
What is the SMILES notation for (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine?
The canonical SMILES for (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine is [H]/N=C(\C=C(\C)N)C(=C)N1CCC(CC)C1.
What is the InChIKey of (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine?
The InChIKey is ODCXUTMXFJHAMC-LTPFSSFFSA-N. The full InChI is InChI=1S/C12H21N3/c1-4-11-5-6-15(8-11)10(3)12(14)7-9(2)13/h7,11,14H,3-6,8,13H2,1-2H3/b9-7-,14-12+.
What are the key properties of (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine?
(2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine has a molecular weight of 207.32 g/mol, XLogP of 2.11, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-5-(3-ethylpyrrolidin-1-yl)-4-iminohexa-2,5-dien-2-amine is sourced from PubChem (CID 178170714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).