About ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide
ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 178170821) has the molecular formula C10H16FNO
and a molecular weight of 185.24 g/mol. Its IUPAC name is ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide.
Molecular Properties
| Compound Name | ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide |
| PubChem CID | 178170821 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | CC.CNC(=O)C1=C(F)CCC=C1 |
| InChI | InChI=1S/C8H10FNO.C2H6/c1-10-8(11)6-4-2-3-5-7(6)9;1-2/h2,4H,3,5H2,1H3,(H,10,11);1-2H3 |
| InChIKey | FOWDWIBAOGRGPW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide?
The IUPAC name of ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide (CID 178170821) is ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide.
What is the SMILES notation for ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide?
The canonical SMILES for ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide is CC.CNC(=O)C1=C(F)CCC=C1.
What is the InChIKey of ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide?
The InChIKey is FOWDWIBAOGRGPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO.C2H6/c1-10-8(11)6-4-2-3-5-7(6)9;1-2/h2,4H,3,5H2,1H3,(H,10,11);1-2H3.
What are the key properties of ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide?
ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide has a molecular weight of 185.24 g/mol, XLogP of 2.33, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-fluoro-N-methylcyclohexa-1,5-diene-1-carboxamide is sourced from PubChem (CID 178170821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).