About 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid
2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid (PubChem CID 178171019) has the molecular formula C12H8F3NO3S
and a molecular weight of 303.26 g/mol. Its IUPAC name is 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 178171019 |
| Molecular Formula | C12H8F3NO3S |
| Molecular Weight | 303.26 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid |
| SMILES | CC(F)(F)c1nc(Oc2ccccc2F)c(C(=O)O)s1 |
| InChI | InChI=1S/C12H8F3NO3S/c1-12(14,15)11-16-9(8(20-11)10(17)18)19-7-5-3-2-4-6(7)13/h2-5H,1H3,(H,17,18) |
| InChIKey | BDCPVHSGXYTZSP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.26 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid (CID 178171019) is 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid is CC(F)(F)c1nc(Oc2ccccc2F)c(C(=O)O)s1.
What is the InChIKey of 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid?
The InChIKey is BDCPVHSGXYTZSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8F3NO3S/c1-12(14,15)11-16-9(8(20-11)10(17)18)19-7-5-3-2-4-6(7)13/h2-5H,1H3,(H,17,18).
What are the key properties of 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid?
2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid has a molecular weight of 303.26 g/mol, XLogP of 3.88, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,1-difluoroethyl)-4-(2-fluorophenoxy)-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 178171019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).