C19H22N4O4P- — CID 178171389
[(1S)-1-[2-(3-cyano-5-methylpyrazol-1-yl)-6-[(2Z,4Z)-3-methylhexa-2,4-dien-2-yl]-3-pyridinyl]ethyl] hydrogen phosphate (PubChem CID 178171389) has the molecular formula C19H22N4O4P- and a molecular weight of 401.38 g/mol. Its IUPAC name is [(1S)-1-[2-(3-cyano-5-methylpyrazol-1-yl)-6-[(2Z,4Z)-3-methylhexa-2,4-dien-2-yl]-3-pyridinyl]ethyl] hydrogen phosphate.
| Compound Name | [(1S)-1-[2-(3-cyano-5-methylpyrazol-1-yl)-6-[(2Z,4Z)-3-methylhexa-2,4-dien-2-yl]-3-pyridinyl]ethyl] hydrogen phosphate |
|---|---|
| PubChem CID | 178171389 |
| Molecular Formula | C19H22N4O4P- |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | [(1S)-1-[2-(3-cyano-5-methylpyrazol-1-yl)-6-[(2Z,4Z)-3-methylhexa-2,4-dien-2-yl]-3-pyridinyl]ethyl] hydrogen phosphate |
| SMILES | C/C=C\C(C)=C(\C)c1ccc([C@H](C)OP(=O)([O-])O)c(-n2nc(C#N)cc2C)n1 |
| InChI | InChI=1S/C19H23N4O4P/c1-6-7-12(2)14(4)18-9-8-17(15(5)27-28(24,25)26)19(21-18)23-13(3)10-16(11-20)22-23/h6-10,15H,1-5H3,(H2,24,25,26)/p-1/b7-6-,14-12-/t15-/m0/s1 |
| InChIKey | JOCVZTCHAFEIED-PXWSWXIRSA-M |
| XLogP | 3.36 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|