C27H40N2 — CID 178171576
ethane;(2E,4E,6Z)-2,6,8-trimethyl-5-methylidene-4-(6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-pentylnona-2,6,8-trienimidamide (PubChem CID 178171576) has the molecular formula C27H40N2 and a molecular weight of 392.63 g/mol. Its IUPAC name is ethane;(2E,4E,6Z)-2,6,8-trimethyl-5-methylidene-4-(6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-pentylnona-2,6,8-trienimidamide.
| Compound Name | ethane;(2E,4E,6Z)-2,6,8-trimethyl-5-methylidene-4-(6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-pentylnona-2,6,8-trienimidamide |
|---|---|
| PubChem CID | 178171576 |
| Molecular Formula | C27H40N2 |
| Molecular Weight | 392.63 g/mol |
| Exact Mass | 392.32 |
| IUPAC Name | ethane;(2E,4E,6Z)-2,6,8-trimethyl-5-methylidene-4-(6-methylidenecyclohexa-2,4-dien-1-ylidene)-N'-pentylnona-2,6,8-trienimidamide |
| SMILES | C=C(C)/C=C(/C)C(=C)C(/C=C(C)/C(N)=N/CCCCC)=c1\ccccc1=C.CC |
| InChI | InChI=1S/C25H34N2.C2H6/c1-8-9-12-15-27-25(26)21(6)17-24(22(7)20(5)16-18(2)3)23-14-11-10-13-19(23)4;1-2/h10-11,13-14,16-17H,2,4,7-9,12,15H2,1,3,5-6H3,(H2,26,27);1-2H3/b20-16-,21-17+,24-23+; |
| InChIKey | LDDBHTKRZRLGNB-PZYCRLNGSA-N |
| XLogP | 5.85 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.63 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|