C12H16N4 — CID 178171862
(Z)-3-methylimino-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)prop-1-en-1-amine (PubChem CID 178171862) has the molecular formula C12H16N4 and a molecular weight of 216.29 g/mol. Its IUPAC name is (Z)-3-methylimino-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)prop-1-en-1-amine.
| Compound Name | (Z)-3-methylimino-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)prop-1-en-1-amine |
|---|---|
| PubChem CID | 178171862 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | (Z)-3-methylimino-2-(5,6,7,8-tetrahydro-1,6-naphthyridin-3-yl)prop-1-en-1-amine |
| SMILES | C/N=C/C(=C\N)c1cnc2c(c1)CNCC2 |
| InChI | InChI=1S/C12H16N4/c1-14-6-11(5-13)9-4-10-7-15-3-2-12(10)16-8-9/h4-6,8,15H,2-3,7,13H2,1H3/b11-5+,14-6+ |
| InChIKey | UXHUNZASJHMNQA-DYWAFWCTSA-N |
| XLogP | 0.73 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|