C18H33N2O+ — CID 178172431
ethane;6-hexyl-1,2-dimethyl-5,6,7,8-tetrahydro-3H-quinazolin-1-ium-4-one (PubChem CID 178172431) has the molecular formula C18H33N2O+ and a molecular weight of 293.48 g/mol. Its IUPAC name is ethane;6-hexyl-1,2-dimethyl-5,6,7,8-tetrahydro-3H-quinazolin-1-ium-4-one.
| Compound Name | ethane;6-hexyl-1,2-dimethyl-5,6,7,8-tetrahydro-3H-quinazolin-1-ium-4-one |
|---|---|
| PubChem CID | 178172431 |
| Molecular Formula | C18H33N2O+ |
| Molecular Weight | 293.48 g/mol |
| Exact Mass | 293.26 |
| IUPAC Name | ethane;6-hexyl-1,2-dimethyl-5,6,7,8-tetrahydro-3H-quinazolin-1-ium-4-one |
| SMILES | CC.CCCCCCC1CCc2c(c(=O)[nH]c(C)[n+]2C)C1 |
| InChI | InChI=1S/C16H26N2O.C2H6/c1-4-5-6-7-8-13-9-10-15-14(11-13)16(19)17-12(2)18(15)3;1-2/h13H,4-11H2,1-3H3;1-2H3/p+1 |
| InChIKey | DLBHDDFBQWLUIG-UHFFFAOYSA-O |
| XLogP | 3.61 |
| TPSA | 36.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|