C19H32N2O2 — CID 178172521
6-methoxy-N,2,2,4,4-pentamethyl-N-(2-pyridin-2-ylethyl)hexanamide (PubChem CID 178172521) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is 6-methoxy-N,2,2,4,4-pentamethyl-N-(2-pyridin-2-ylethyl)hexanamide.
| Compound Name | 6-methoxy-N,2,2,4,4-pentamethyl-N-(2-pyridin-2-ylethyl)hexanamide |
|---|---|
| PubChem CID | 178172521 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 6-methoxy-N,2,2,4,4-pentamethyl-N-(2-pyridin-2-ylethyl)hexanamide |
| SMILES | COCCC(C)(C)CC(C)(C)C(=O)N(C)CCc1ccccn1 |
| InChI | InChI=1S/C19H32N2O2/c1-18(2,11-14-23-6)15-19(3,4)17(22)21(5)13-10-16-9-7-8-12-20-16/h7-9,12H,10-11,13-15H2,1-6H3 |
| InChIKey | KWQBKHZYQPNRPU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |