About ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate
ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate (PubChem CID 178172563) has the molecular formula C11H18N2O2
and a molecular weight of 210.28 g/mol. Its IUPAC name is ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate.
Molecular Properties
| Compound Name | ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate |
| PubChem CID | 178172563 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate |
| SMILES | CCOC(=O)N(C)CCC1=NCCC=C1 |
| InChI | InChI=1S/C11H18N2O2/c1-3-15-11(14)13(2)9-7-10-6-4-5-8-12-10/h4,6H,3,5,7-9H2,1-2H3 |
| InChIKey | KFBSISAXFMQXNB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate?
The IUPAC name of ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate (CID 178172563) is ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate.
What is the SMILES notation for ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate?
The canonical SMILES for ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate is CCOC(=O)N(C)CCC1=NCCC=C1.
What is the InChIKey of ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate?
The InChIKey is KFBSISAXFMQXNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O2/c1-3-15-11(14)13(2)9-7-10-6-4-5-8-12-10/h4,6H,3,5,7-9H2,1-2H3.
What are the key properties of ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate?
ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate has a molecular weight of 210.28 g/mol, XLogP of 1.87, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[2-(2,3-dihydropyridin-6-yl)ethyl]-N-methylcarbamate is sourced from PubChem (CID 178172563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).